C15H17N3O2S — CID 48577750
N-(3-acetamido-4-methylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide (PubChem CID 48577750) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(3-acetamido-4-methylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-acetamido-4-methylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 48577750 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(3-acetamido-4-methylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)Nc2ccc(C)c(NC(C)=O)c2)s1 |
| InChI | InChI=1S/C15H17N3O2S/c1-4-14-16-8-13(21-14)15(20)18-11-6-5-9(2)12(7-11)17-10(3)19/h5-8H,4H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | WOPIWHHKPCBUPG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |