C18H24N2O3S — CID 86857677
2-ethyl-N-[3-(2-propan-2-yloxyethoxymethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 86857677) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-ethyl-N-[3-(2-propan-2-yloxyethoxymethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-ethyl-N-[3-(2-propan-2-yloxyethoxymethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 86857677 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-ethyl-N-[3-(2-propan-2-yloxyethoxymethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)Nc2cccc(COCCOC(C)C)c2)s1 |
| InChI | InChI=1S/C18H24N2O3S/c1-4-17-19-11-16(24-17)18(21)20-15-7-5-6-14(10-15)12-22-8-9-23-13(2)3/h5-7,10-11,13H,4,8-9,12H2,1-3H3,(H,20,21) |
| InChIKey | UGZPIVCZPVFONS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|