C17H20ClNO4 — CID 124877623
N-[(2S)-2-(2-chlorophenoxy)butyl]-5-(hydroxymethyl)-3-methylfuran-2-carboxamide (PubChem CID 124877623) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenoxy)butyl]-5-(hydroxymethyl)-3-methylfuran-2-carboxamide.
| Compound Name | N-[(2S)-2-(2-chlorophenoxy)butyl]-5-(hydroxymethyl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 124877623 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenoxy)butyl]-5-(hydroxymethyl)-3-methylfuran-2-carboxamide |
| SMILES | CC[C@@H](CNC(=O)c1oc(CO)cc1C)Oc1ccccc1Cl |
| InChI | InChI=1S/C17H20ClNO4/c1-3-12(22-15-7-5-4-6-14(15)18)9-19-17(21)16-11(2)8-13(10-20)23-16/h4-8,12,20H,3,9-10H2,1-2H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | VWAKQBWFJCSJNU-LBPRGKRZSA-N |
| XLogP | 3.32 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |