C27H30N2O6 — CID 124878472
methyl (3S)-3-[3-hydroxy-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxopyran-2-yl]-3-phenylpropanoate (PubChem CID 124878472) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is methyl (3S)-3-[3-hydroxy-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxopyran-2-yl]-3-phenylpropanoate.
| Compound Name | methyl (3S)-3-[3-hydroxy-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxopyran-2-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 124878472 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | methyl (3S)-3-[3-hydroxy-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxopyran-2-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1)c1oc(CN2CCN(c3ccc(OC)cc3)CC2)cc(=O)c1O |
| InChI | InChI=1S/C27H30N2O6/c1-33-21-10-8-20(9-11-21)29-14-12-28(13-15-29)18-22-16-24(30)26(32)27(35-22)23(17-25(31)34-2)19-6-4-3-5-7-19/h3-11,16,23,32H,12-15,17-18H2,1-2H3/t23-/m0/s1 |
| InChIKey | LATQHMWJJOSSSR-QHCPKHFHSA-N |
| XLogP | 3.37 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|