C20H23NO6 — CID 99996401
methyl (3S)-3-[3-hydroxy-6-(morpholin-4-ylmethyl)-4-oxopyran-2-yl]-3-phenylpropanoate (PubChem CID 99996401) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl (3S)-3-[3-hydroxy-6-(morpholin-4-ylmethyl)-4-oxopyran-2-yl]-3-phenylpropanoate.
| Compound Name | methyl (3S)-3-[3-hydroxy-6-(morpholin-4-ylmethyl)-4-oxopyran-2-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 99996401 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl (3S)-3-[3-hydroxy-6-(morpholin-4-ylmethyl)-4-oxopyran-2-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1)c1oc(CN2CCOCC2)cc(=O)c1O |
| InChI | InChI=1S/C20H23NO6/c1-25-18(23)12-16(14-5-3-2-4-6-14)20-19(24)17(22)11-15(27-20)13-21-7-9-26-10-8-21/h2-6,11,16,24H,7-10,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | NHLLDMJQIDXKTI-INIZCTEOSA-N |
| XLogP | 1.87 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |