C22H20O5S — CID 97263954
methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-phenylpropanoate (PubChem CID 97263954) has the molecular formula C22H20O5S and a molecular weight of 396.46 g/mol. Its IUPAC name is methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-phenylpropanoate.
| Compound Name | methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 97263954 |
| Molecular Formula | C22H20O5S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1)c1oc(CSc2ccccc2)cc(=O)c1O |
| InChI | InChI=1S/C22H20O5S/c1-26-20(24)13-18(15-8-4-2-5-9-15)22-21(25)19(23)12-16(27-22)14-28-17-10-6-3-7-11-17/h2-12,18,25H,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | VBAFFRNBPOXUHT-SFHVURJKSA-N |
| XLogP | 4.33 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |