C20H27N3O — CID 124878513
(2R)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-phenyl-2-pyrrol-1-ylpropanamide (PubChem CID 124878513) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is (2R)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-phenyl-2-pyrrol-1-ylpropanamide.
| Compound Name | (2R)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-phenyl-2-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 124878513 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (2R)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-phenyl-2-pyrrol-1-ylpropanamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)[C@@H](Cc1ccccc1)n1cccc1 |
| InChI | InChI=1S/C20H27N3O/c1-2-22-14-8-11-18(22)16-21-20(24)19(23-12-6-7-13-23)15-17-9-4-3-5-10-17/h3-7,9-10,12-13,18-19H,2,8,11,14-16H2,1H3,(H,21,24)/t18-,19-/m1/s1 |
| InChIKey | LEXFSZZAGBNIPR-RTBURBONSA-N |
| XLogP | 2.87 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |