C18H23BrN2O2 — CID 124881184
(3S)-N-(3-bromophenyl)-1-cyclopentyl-N-ethyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 124881184) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is (3S)-N-(3-bromophenyl)-1-cyclopentyl-N-ethyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(3-bromophenyl)-1-cyclopentyl-N-ethyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124881184 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (3S)-N-(3-bromophenyl)-1-cyclopentyl-N-ethyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCN(C(=O)[C@H]1CC(=O)N(C2CCCC2)C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H23BrN2O2/c1-2-20(16-9-5-6-14(19)11-16)18(23)13-10-17(22)21(12-13)15-7-3-4-8-15/h5-6,9,11,13,15H,2-4,7-8,10,12H2,1H3/t13-/m0/s1 |
| InChIKey | RUFCEYUENZNHEF-ZDUSSCGKSA-N |
| XLogP | 3.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |