C19H18Cl2N2O2 — CID 113191384
1-(2,3-dichlorophenyl)-N-ethyl-5-oxo-N-phenylpyrrolidine-3-carboxamide (PubChem CID 113191384) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-ethyl-5-oxo-N-phenylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2,3-dichlorophenyl)-N-ethyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113191384 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-ethyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
| SMILES | CCN(C(=O)C1CC(=O)N(c2cccc(Cl)c2Cl)C1)c1ccccc1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-2-22(14-7-4-3-5-8-14)19(25)13-11-17(24)23(12-13)16-10-6-9-15(20)18(16)21/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | AOLDQDKMVQJWAG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |