C17H19N3O2 — CID 124882003
1-[(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-2-pyrimidin-5-ylethanone (PubChem CID 124882003) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-2-pyrimidin-5-ylethanone.
| Compound Name | 1-[(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-2-pyrimidin-5-ylethanone |
|---|---|
| PubChem CID | 124882003 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-[(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-2-pyrimidin-5-ylethanone |
| SMILES | C[C@H]1CN(C(=O)Cc2cncnc2)[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C17H19N3O2/c1-13-10-20(17(21)7-14-8-18-12-19-9-14)16(11-22-13)15-5-3-2-4-6-15/h2-6,8-9,12-13,16H,7,10-11H2,1H3/t13-,16+/m0/s1 |
| InChIKey | DEWXSAZTIROLFR-XJKSGUPXSA-N |
| XLogP | 2.01 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |