C15H22N2O2 — CID 124890111
(2S)-2-amino-1-[(2S,5R)-2-methyl-5-phenylmorpholin-4-yl]butan-1-one (PubChem CID 124890111) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2S)-2-amino-1-[(2S,5R)-2-methyl-5-phenylmorpholin-4-yl]butan-1-one.
| Compound Name | (2S)-2-amino-1-[(2S,5R)-2-methyl-5-phenylmorpholin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 124890111 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2S)-2-amino-1-[(2S,5R)-2-methyl-5-phenylmorpholin-4-yl]butan-1-one |
| SMILES | CC[C@H](N)C(=O)N1C[C@H](C)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-13(16)15(18)17-9-11(2)19-10-14(17)12-7-5-4-6-8-12/h4-8,11,13-14H,3,9-10,16H2,1-2H3/t11-,13-,14-/m0/s1 |
| InChIKey | NKALIXWFNBCPJQ-UBHSHLNASA-N |
| XLogP | 1.71 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |