C14H23N3O3S2 — CID 124882355
(2R)-N-[5-(tert-butylsulfamoyl)-2-pyridinyl]-2-methyl-3-methylsulfanylpropanamide (PubChem CID 124882355) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2R)-N-[5-(tert-butylsulfamoyl)-2-pyridinyl]-2-methyl-3-methylsulfanylpropanamide.
| Compound Name | (2R)-N-[5-(tert-butylsulfamoyl)-2-pyridinyl]-2-methyl-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 124882355 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2R)-N-[5-(tert-butylsulfamoyl)-2-pyridinyl]-2-methyl-3-methylsulfanylpropanamide |
| SMILES | CSC[C@H](C)C(=O)Nc1ccc(S(=O)(=O)NC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-10(9-21-5)13(18)16-12-7-6-11(8-15-12)22(19,20)17-14(2,3)4/h6-8,10,17H,9H2,1-5H3,(H,15,16,18)/t10-/m0/s1 |
| InChIKey | WNVPNJHXJDFJNP-JTQLQIEISA-N |
| XLogP | 2.10 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |