C20H20N6O — CID 124882661
2,3-dihydroindol-1-yl-[(1R,2S,4R)-7-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)-7-azabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 124882661) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[(1R,2S,4R)-7-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)-7-azabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[(1R,2S,4R)-7-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)-7-azabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 124882661 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[(1R,2S,4R)-7-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)-7-azabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | O=C([C@H]1C[C@H]2CC[C@H]1N2c1nccn2cnnc12)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H20N6O/c27-20(25-9-7-13-3-1-2-4-16(13)25)15-11-14-5-6-17(15)26(14)18-19-23-22-12-24(19)10-8-21-18/h1-4,8,10,12,14-15,17H,5-7,9,11H2/t14-,15+,17-/m1/s1 |
| InChIKey | GZFUUTMBHLZQSS-HLLBOEOZSA-N |
| XLogP | 2.07 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |