C16H21FN2O5 — CID 124883252
methyl (2S)-3-[4-[(4-fluorobenzoyl)amino]butanoylamino]-2-methoxypropanoate (PubChem CID 124883252) has the molecular formula C16H21FN2O5 and a molecular weight of 340.35 g/mol. Its IUPAC name is methyl (2S)-3-[4-[(4-fluorobenzoyl)amino]butanoylamino]-2-methoxypropanoate.
| Compound Name | methyl (2S)-3-[4-[(4-fluorobenzoyl)amino]butanoylamino]-2-methoxypropanoate |
|---|---|
| PubChem CID | 124883252 |
| Molecular Formula | C16H21FN2O5 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl (2S)-3-[4-[(4-fluorobenzoyl)amino]butanoylamino]-2-methoxypropanoate |
| SMILES | COC(=O)[C@H](CNC(=O)CCCNC(=O)c1ccc(F)cc1)OC |
| InChI | InChI=1S/C16H21FN2O5/c1-23-13(16(22)24-2)10-19-14(20)4-3-9-18-15(21)11-5-7-12(17)8-6-11/h5-8,13H,3-4,9-10H2,1-2H3,(H,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | LSMALFOOWYSYLA-ZDUSSCGKSA-N |
| XLogP | 0.64 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|