C20H29N3O2 — CID 124883990
(2S,3R)-N-[(3R,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]-2-prop-1-en-2-yloxolane-3-carboxamide (PubChem CID 124883990) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (2S,3R)-N-[(3R,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]-2-prop-1-en-2-yloxolane-3-carboxamide.
| Compound Name | (2S,3R)-N-[(3R,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]-2-prop-1-en-2-yloxolane-3-carboxamide |
|---|---|
| PubChem CID | 124883990 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (2S,3R)-N-[(3R,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]-2-prop-1-en-2-yloxolane-3-carboxamide |
| SMILES | C=C(C)[C@H]1OCC[C@H]1C(=O)N[C@H]1CCN(Cc2ccccn2)C[C@H]1C |
| InChI | InChI=1S/C20H29N3O2/c1-14(2)19-17(8-11-25-19)20(24)22-18-7-10-23(12-15(18)3)13-16-6-4-5-9-21-16/h4-6,9,15,17-19H,1,7-8,10-13H2,2-3H3,(H,22,24)/t15-,17-,18+,19-/m1/s1 |
| InChIKey | SJMFPCANFRRJKB-OQIJWPOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|