C15H25N3O3 — CID 124885376
(5R)-5-tert-butyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 124885376) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (5R)-5-tert-butyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-tert-butyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124885376 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (5R)-5-tert-butyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CCCN(C(=O)CN2C(=O)N[C@H](C(C)(C)C)C2=O)C1 |
| InChI | InChI=1S/C15H25N3O3/c1-10-6-5-7-17(8-10)11(19)9-18-13(20)12(15(2,3)4)16-14(18)21/h10,12H,5-9H2,1-4H3,(H,16,21)/t10-,12+/m1/s1 |
| InChIKey | PHVOYGCHBWZVKU-PWSUYJOCSA-N |
| XLogP | 1.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|