C16H23N3O2S — CID 124886748
1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-4-(1-methylpyrazol-4-yl)butane-1,4-dione (PubChem CID 124886748) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-4-(1-methylpyrazol-4-yl)butane-1,4-dione.
| Compound Name | 1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-4-(1-methylpyrazol-4-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 124886748 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-4-(1-methylpyrazol-4-yl)butane-1,4-dione |
| SMILES | Cn1cc(C(=O)CCC(=O)N2CCS[C@H]3CCCC[C@H]32)cn1 |
| InChI | InChI=1S/C16H23N3O2S/c1-18-11-12(10-17-18)14(20)6-7-16(21)19-8-9-22-15-5-3-2-4-13(15)19/h10-11,13,15H,2-9H2,1H3/t13-,15+/m1/s1 |
| InChIKey | HKAUUUBYOJKQNU-HIFRSBDPSA-N |
| XLogP | 2.27 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |