C15H23N3OS — CID 125140028
1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one (PubChem CID 125140028) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one.
| Compound Name | 1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 125140028 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one |
| SMILES | Cn1cncc1CCC(=O)N1CCS[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H23N3OS/c1-17-11-16-10-12(17)6-7-15(19)18-8-9-20-14-5-3-2-4-13(14)18/h10-11,13-14H,2-9H2,1H3/t13-,14+/m1/s1 |
| InChIKey | RMZZULQHJSZYMY-KGLIPLIRSA-N |
| XLogP | 2.24 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |