C14H23N3O3 — CID 154739322
1-[3-(2-methoxyethyl)morpholin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one (PubChem CID 154739322) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[3-(2-methoxyethyl)morpholin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one.
| Compound Name | 1-[3-(2-methoxyethyl)morpholin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 154739322 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-[3-(2-methoxyethyl)morpholin-4-yl]-3-(3-methylimidazol-4-yl)propan-1-one |
| SMILES | COCCC1COCCN1C(=O)CCc1cncn1C |
| InChI | InChI=1S/C14H23N3O3/c1-16-11-15-9-12(16)3-4-14(18)17-6-8-20-10-13(17)5-7-19-2/h9,11,13H,3-8,10H2,1-2H3 |
| InChIKey | ORNSYUGHHNCTHY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |