C14H19NO6 — CID 136544076
5-methoxy-2-[3-(2-methoxyethyl)morpholine-4-carbonyl]pyran-4-one (PubChem CID 136544076) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-methoxy-2-[3-(2-methoxyethyl)morpholine-4-carbonyl]pyran-4-one.
| Compound Name | 5-methoxy-2-[3-(2-methoxyethyl)morpholine-4-carbonyl]pyran-4-one |
|---|---|
| PubChem CID | 136544076 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 5-methoxy-2-[3-(2-methoxyethyl)morpholine-4-carbonyl]pyran-4-one |
| SMILES | COCCC1COCCN1C(=O)c1cc(=O)c(OC)co1 |
| InChI | InChI=1S/C14H19NO6/c1-18-5-3-10-8-20-6-4-15(10)14(17)12-7-11(16)13(19-2)9-21-12/h7,9-10H,3-6,8H2,1-2H3 |
| InChIKey | BHYBQJMOGJTFKH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |