C17H20N2O4 — CID 125141713
5-methoxy-2-[(2S)-2-(1-methylpyrrol-2-yl)piperidine-1-carbonyl]pyran-4-one (PubChem CID 125141713) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 5-methoxy-2-[(2S)-2-(1-methylpyrrol-2-yl)piperidine-1-carbonyl]pyran-4-one.
| Compound Name | 5-methoxy-2-[(2S)-2-(1-methylpyrrol-2-yl)piperidine-1-carbonyl]pyran-4-one |
|---|---|
| PubChem CID | 125141713 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 5-methoxy-2-[(2S)-2-(1-methylpyrrol-2-yl)piperidine-1-carbonyl]pyran-4-one |
| SMILES | COc1coc(C(=O)N2CCCC[C@H]2c2cccn2C)cc1=O |
| InChI | InChI=1S/C17H20N2O4/c1-18-8-5-7-12(18)13-6-3-4-9-19(13)17(21)15-10-14(20)16(22-2)11-23-15/h5,7-8,10-11,13H,3-4,6,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | SPIUFBPJYLSTIX-ZDUSSCGKSA-N |
| XLogP | 2.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |