C16H20ClN3O2S — CID 124890385
N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methylpyridine-3-sulfonamide (PubChem CID 124890385) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methylpyridine-3-sulfonamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 124890385 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methylpyridine-3-sulfonamide |
| SMILES | Cc1ccncc1S(=O)(=O)NC[C@H](c1ccccc1Cl)N(C)C |
| InChI | InChI=1S/C16H20ClN3O2S/c1-12-8-9-18-11-16(12)23(21,22)19-10-15(20(2)3)13-6-4-5-7-14(13)17/h4-9,11,15,19H,10H2,1-3H3/t15-/m1/s1 |
| InChIKey | SRPZLRWCGNTYCZ-OAHLLOKOSA-N |
| XLogP | 2.62 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |