C16H24N4O3 — CID 124892168
N-(4-methylpiperazin-1-yl)-6-[[(2S)-oxolan-2-yl]methoxy]pyridine-3-carboxamide (PubChem CID 124892168) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-6-[[(2S)-oxolan-2-yl]methoxy]pyridine-3-carboxamide.
| Compound Name | N-(4-methylpiperazin-1-yl)-6-[[(2S)-oxolan-2-yl]methoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124892168 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-6-[[(2S)-oxolan-2-yl]methoxy]pyridine-3-carboxamide |
| SMILES | CN1CCN(NC(=O)c2ccc(OC[C@@H]3CCCO3)nc2)CC1 |
| InChI | InChI=1S/C16H24N4O3/c1-19-6-8-20(9-7-19)18-16(21)13-4-5-15(17-11-13)23-12-14-3-2-10-22-14/h4-5,11,14H,2-3,6-10,12H2,1H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | NPXYQBLCABNWDO-AWEZNQCLSA-N |
| XLogP | 0.53 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |