C11H15NO3 — CID 61255283
[6-(oxolan-2-ylmethoxy)-3-pyridinyl]methanol (PubChem CID 61255283) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is [6-(oxolan-2-ylmethoxy)-3-pyridinyl]methanol.
| Compound Name | [6-(oxolan-2-ylmethoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 61255283 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | [6-(oxolan-2-ylmethoxy)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(OCC2CCCO2)nc1 |
| InChI | InChI=1S/C11H15NO3/c13-7-9-3-4-11(12-6-9)15-8-10-2-1-5-14-10/h3-4,6,10,13H,1-2,5,7-8H2 |
| InChIKey | YFPQSLQAZKATKO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |