C18H20N2O4 — CID 124893418
[(4aR,7R,7aS)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone (PubChem CID 124893418) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is [(4aR,7R,7aS)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone.
| Compound Name | [(4aR,7R,7aS)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 124893418 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [(4aR,7R,7aS)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1CCO[C@H]2[C@H]1CC[C@H]2Oc1ccccn1 |
| InChI | InChI=1S/C18H20N2O4/c1-12-7-10-22-16(12)18(21)20-9-11-23-17-13(20)5-6-14(17)24-15-4-2-3-8-19-15/h2-4,7-8,10,13-14,17H,5-6,9,11H2,1H3/t13-,14-,17+/m1/s1 |
| InChIKey | IEPNVNDFASHONN-CPUCHLNUSA-N |
| XLogP | 2.43 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |