C17H18N2O4 — CID 133137659
[(3R,3aR,7aS)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(furan-2-yl)methanone (PubChem CID 133137659) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is [(3R,3aR,7aS)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(furan-2-yl)methanone.
| Compound Name | [(3R,3aR,7aS)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 133137659 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [(3R,3aR,7aS)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1C[C@@H](Oc2ccccn2)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C17H18N2O4/c20-17(13-6-4-9-21-13)19-11-14(16-12(19)5-3-10-22-16)23-15-7-1-2-8-18-15/h1-2,4,6-9,12,14,16H,3,5,10-11H2/t12-,14+,16+/m0/s1 |
| InChIKey | LEEWSPPOSWSCCB-JGGQBBKZSA-N |
| XLogP | 2.13 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |