C19H20FN3O3 — CID 131682100
1-[(3S,3aS,7aR)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone (PubChem CID 131682100) has the molecular formula C19H20FN3O3 and a molecular weight of 357.38 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone.
| Compound Name | 1-[(3S,3aS,7aR)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 131682100 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[(3S,3aS,7aR)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cn1)N1C[C@H](Oc2ccccn2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C19H20FN3O3/c20-13-6-7-14(22-11-13)10-18(24)23-12-16(19-15(23)4-3-9-25-19)26-17-5-1-2-8-21-17/h1-2,5-8,11,15-16,19H,3-4,9-10,12H2/t15-,16+,19+/m1/s1 |
| InChIKey | KTDQIGUZYNFBKX-GJYPPUQNSA-N |
| XLogP | 2.00 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |