C20H20N4O2S2 — CID 124896101
(4S)-2,7,7-trimethyl-4-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 124896101) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is (4S)-2,7,7-trimethyl-4-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2,7,7-trimethyl-4-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 124896101 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (4S)-2,7,7-trimethyl-4-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1=C(C#N)[C@H](c2ccc(Sc3nnc(C)s3)o2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C20H20N4O2S2/c1-10-12(9-21)17(18-13(22-10)7-20(3,4)8-14(18)25)15-5-6-16(26-15)28-19-24-23-11(2)27-19/h5-6,17,22H,7-8H2,1-4H3/t17-/m1/s1 |
| InChIKey | LAGYPBWRQLUHST-QGZVFWFLSA-N |
| XLogP | 4.72 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |