C18H18ClN3O — CID 51058044
4-(6-chloro-3-pyridinyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 51058044) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is 4-(6-chloro-3-pyridinyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 4-(6-chloro-3-pyridinyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 51058044 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-(6-chloro-3-pyridinyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1=C(C#N)C(c2ccc(Cl)nc2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C18H18ClN3O/c1-10-12(8-20)16(11-4-5-15(19)21-9-11)17-13(22-10)6-18(2,3)7-14(17)23/h4-5,9,16,22H,6-7H2,1-3H3 |
| InChIKey | MKKFHVLVARGCQU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|