C14H11ClN4 — CID 51057968
4-(6-chloro-3-pyridinyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile (PubChem CID 51057968) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-(6-chloro-3-pyridinyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | 4-(6-chloro-3-pyridinyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 51057968 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(6-chloro-3-pyridinyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile |
| SMILES | CC1=C(C#N)C(c2ccc(Cl)nc2)C(C#N)=C(C)N1 |
| InChI | InChI=1S/C14H11ClN4/c1-8-11(5-16)14(12(6-17)9(2)19-8)10-3-4-13(15)18-7-10/h3-4,7,14,19H,1-2H3 |
| InChIKey | GASOQOXGZUPIPR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|