C38H48O3 — CID 124897907
[(3R,8R,9R,10R,13S,14S,17S)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124897907) has the molecular formula C38H48O3 and a molecular weight of 552.80 g/mol. Its IUPAC name is [(3R,8R,9R,10R,13S,14S,17S)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,8R,9R,10R,13S,14S,17S)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124897907 |
| Molecular Formula | C38H48O3 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | [(3R,8R,9R,10R,13S,14S,17S)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@H]2CC[C@@]2(C)[C@H]3CC[C@@H]2[C@]2(C)CCC(c3ccccc3)(c3ccccc3)O2)C1 |
| InChI | InChI=1S/C38H48O3/c1-26(39)40-30-19-21-35(2)29(25-30)15-16-31-32-17-18-34(36(32,3)22-20-33(31)35)37(4)23-24-38(41-37,27-11-7-5-8-12-27)28-13-9-6-10-14-28/h5-15,30-34H,16-25H2,1-4H3/t30-,31-,32+,33-,34+,35+,36+,37+/m1/s1 |
| InChIKey | XDLGHSSBPPLKGN-OMWUWDSKSA-N |
| XLogP | 9.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|