C33H42N2O10 — CID 124898949
5,7-dihydroxy-6,8-bis(piperidin-1-ylmethyl)-3-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one (PubChem CID 124898949) has the molecular formula C33H42N2O10 and a molecular weight of 626.70 g/mol. Its IUPAC name is 5,7-dihydroxy-6,8-bis(piperidin-1-ylmethyl)-3-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-6,8-bis(piperidin-1-ylmethyl)-3-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
|---|---|
| PubChem CID | 124898949 |
| Molecular Formula | C33H42N2O10 |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 5,7-dihydroxy-6,8-bis(piperidin-1-ylmethyl)-3-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
| SMILES | O=c1c(-c2ccc(O[C@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]3O)cc2)coc2c(CN3CCCCC3)c(O)c(CN3CCCCC3)c(O)c12 |
| InChI | InChI=1S/C33H42N2O10/c36-17-24-29(40)30(41)31(42)33(45-24)44-20-9-7-19(8-10-20)23-18-43-32-22(16-35-13-5-2-6-14-35)26(37)21(27(38)25(32)28(23)39)15-34-11-3-1-4-12-34/h7-10,18,24,29-31,33,36-38,40-42H,1-6,11-17H2/t24-,29-,30+,31-,33-/m0/s1 |
| InChIKey | ZKPRSFXPAYNIJS-RKFLPCAWSA-N |
| XLogP | 2.02 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|