C20H21NO5 — CID 124902177
(1R,2S,6R,14R,15R,16R)-11,15-dihydroxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid (PubChem CID 124902177) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (1R,2S,6R,14R,15R,16R)-11,15-dihydroxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid.
| Compound Name | (1R,2S,6R,14R,15R,16R)-11,15-dihydroxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid |
|---|---|
| PubChem CID | 124902177 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (1R,2S,6R,14R,15R,16R)-11,15-dihydroxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@]2(O)C=C[C@@]3(C[C@H]2C(=O)O)[C@H]1C5 |
| InChI | InChI=1S/C20H21NO5/c1-21-7-6-19-14-10-2-3-12(22)15(14)26-17(19)20(25)5-4-18(19,13(21)8-10)9-11(20)16(23)24/h2-5,11,13,17,22,25H,6-9H2,1H3,(H,23,24)/t11-,13+,17+,18+,19-,20+/m0/s1 |
| InChIKey | PHVHFUCWRHIUOT-HTQFWGHXSA-N |
| XLogP | 1.04 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|