C22H26BN2O4 — CID 59939601
CID 59939601 (PubChem CID 59939601) has the molecular formula C22H26BN2O4 and a molecular weight of 393.27 g/mol.
| Compound Name | CID 59939601 |
|---|---|
| PubChem CID | 59939601 |
| Molecular Formula | C22H26BN2O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | — |
| SMILES | C[B]N(C)C(=O)[C@H]1C[C@@]23C=CC1(O)C1Oc4c(O)ccc5c4[C@@]12CCN(C)[C@@H]3C5 |
| InChI | InChI=1S/C22H26BN2O4/c1-23-25(3)18(27)13-11-20-6-7-22(13,28)19-21(20)8-9-24(2)15(20)10-12-4-5-14(26)17(29-19)16(12)21/h4-7,13,15,19,26,28H,8-11H2,1-3H3/t13-,15-,19?,20-,21+,22?/m1/s1 |
| InChIKey | BZRMFSGYUIQBHU-ZDQCSHPBSA-N |
| XLogP | 1.08 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|