C23H28BN2O4 — CID 59939569
CID 59939569 (PubChem CID 59939569) has the molecular formula C23H28BN2O4 and a molecular weight of 407.30 g/mol.
| Compound Name | CID 59939569 |
|---|---|
| PubChem CID | 59939569 |
| Molecular Formula | C23H28BN2O4 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | — |
| SMILES | C[B]C(=O)N(C)C1C[C@@]23C=CC1(O)C1Oc4c(OC)ccc5c4[C@@]12CCN(C)[C@@H]3C5 |
| InChI | InChI=1S/C23H28BN2O4/c1-24-20(27)26(3)16-12-21-7-8-23(16,28)19-22(21)9-10-25(2)15(21)11-13-5-6-14(29-4)18(30-19)17(13)22/h5-8,15-16,19,28H,9-12H2,1-4H3/t15-,16?,19?,21-,22+,23?/m1/s1 |
| InChIKey | VBVSQMUKTAKNDR-GMHDGXCWSA-N |
| XLogP | 1.82 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|