C23H43NO3 — CID 124904870
1-[(2S)-2-hydroxy-4-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 124904870) has the molecular formula C23H43NO3 and a molecular weight of 381.60 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-4-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[(2S)-2-hydroxy-4-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 124904870 |
| Molecular Formula | C23H43NO3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | 1-[(2S)-2-hydroxy-4-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1C[C@@H](O)CCO[C@@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C23H43NO3/c1-20(2)13-18(26)14-21(3,4)24(20)15-17(25)9-11-27-19-12-16-8-10-23(19,7)22(16,5)6/h16-19,25-26H,8-15H2,1-7H3/t16-,17+,19-,23-/m1/s1 |
| InChIKey | LVHVVULBVCVEDK-PDPLOHQNSA-N |
| XLogP | 3.98 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |