C22H41NO3 — CID 98182532
1-[(2S)-2-hydroxy-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propyl]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 98182532) has the molecular formula C22H41NO3 and a molecular weight of 367.57 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propyl]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[(2S)-2-hydroxy-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propyl]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 98182532 |
| Molecular Formula | C22H41NO3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | 1-[(2S)-2-hydroxy-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propyl]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1C[C@H](O)CO[C@@H]1C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C22H41NO3/c1-19(2)11-16(24)12-20(3,4)23(19)13-17(25)14-26-18-10-15-8-9-22(18,7)21(15,5)6/h15-18,24-25H,8-14H2,1-7H3/t15-,17-,18+,22-/m0/s1 |
| InChIKey | NVKSSTCWFDFJDJ-FCQWJQKHSA-N |
| XLogP | 3.59 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |