C20H37NO2 — CID 124827311
(2S)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol (PubChem CID 124827311) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is (2S)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol.
| Compound Name | (2S)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 124827311 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | (2S)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol |
| SMILES | C[C@@H]1C[C@H](C)CN(C[C@H](O)CO[C@H]2C[C@H]3CC[C@@]2(C)C3(C)C)C1 |
| InChI | InChI=1S/C20H37NO2/c1-14-8-15(2)11-21(10-14)12-17(22)13-23-18-9-16-6-7-20(18,5)19(16,3)4/h14-18,22H,6-13H2,1-5H3/t14-,15+,16-,17+,18+,20-/m1/s1 |
| InChIKey | KLAVVVARGBVTEU-NJHADGRTSA-N |
| XLogP | 3.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |