C22H33NO2 — CID 98182491
(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol (PubChem CID 98182491) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol.
| Compound Name | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 98182491 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]propan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](OC[C@H](O)CN1CCc3ccccc3C1)C2 |
| InChI | InChI=1S/C22H33NO2/c1-21(2)18-8-10-22(21,3)20(12-18)25-15-19(24)14-23-11-9-16-6-4-5-7-17(16)13-23/h4-7,18-20,24H,8-15H2,1-3H3/t18-,19+,20+,22-/m0/s1 |
| InChIKey | HFYVOEARROQXFB-HIUFNZKISA-N |
| XLogP | 3.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |