C6H6N8 — CID 124907743
1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaen-7-ylhydrazine (PubChem CID 124907743) has the molecular formula C6H6N8 and a molecular weight of 190.17 g/mol. Its IUPAC name is 1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaen-7-ylhydrazine.
| Compound Name | 1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaen-7-ylhydrazine |
|---|---|
| PubChem CID | 124907743 |
| Molecular Formula | C6H6N8 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaen-7-ylhydrazine |
| SMILES | NNc1cc2nncn2c2ncnn12 |
| InChI | InChI=1S/C6H6N8/c7-11-4-1-5-12-9-3-13(5)6-8-2-10-14(4)6/h1-3,11H,7H2 |
| InChIKey | FKTPESIVZYHAHM-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|