C6H3ClN6 — CID 124908977
7-chloro-1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene (PubChem CID 124908977) has the molecular formula C6H3ClN6 and a molecular weight of 194.59 g/mol. Its IUPAC name is 7-chloro-1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene.
| Compound Name | 7-chloro-1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 124908977 |
| Molecular Formula | C6H3ClN6 |
| Molecular Weight | 194.59 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 7-chloro-1,3,5,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
| SMILES | Clc1cc2nncn2c2ncnn12 |
| InChI | InChI=1S/C6H3ClN6/c7-4-1-5-11-9-3-12(5)6-8-2-10-13(4)6/h1-3H |
| InChIKey | WWFNZKIDJSPVAY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.59 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |