C6H6ClN3 — CID 144630421
4-(1-chloroethenyl)-3-ethenyl-1,2,4-triazole (PubChem CID 144630421) has the molecular formula C6H6ClN3 and a molecular weight of 155.59 g/mol. Its IUPAC name is 4-(1-chloroethenyl)-3-ethenyl-1,2,4-triazole.
| Compound Name | 4-(1-chloroethenyl)-3-ethenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 144630421 |
| Molecular Formula | C6H6ClN3 |
| Molecular Weight | 155.59 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 4-(1-chloroethenyl)-3-ethenyl-1,2,4-triazole |
| SMILES | C=Cc1nncn1C(=C)Cl |
| InChI | InChI=1S/C6H6ClN3/c1-3-6-9-8-4-10(6)5(2)7/h3-4H,1-2H2 |
| InChIKey | VNVBBYHLYVTSAF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.59 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |