C7H6N6 — CID 15618573
7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene (PubChem CID 15618573) has the molecular formula C7H6N6 and a molecular weight of 174.17 g/mol. Its IUPAC name is 7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene.
| Compound Name | 7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 15618573 |
| Molecular Formula | C7H6N6 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
| SMILES | Cc1cc2nncn2c2nncn12 |
| InChI | InChI=1S/C7H6N6/c1-5-2-6-10-8-4-13(6)7-11-9-3-12(5)7/h2-4H,1H3 |
| InChIKey | PATJTHFGUUMVGM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |