C9H10N6 — CID 12581793
5,7,12-trimethyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene (PubChem CID 12581793) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is 5,7,12-trimethyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene.
| Compound Name | 5,7,12-trimethyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 12581793 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5,7,12-trimethyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
| SMILES | Cc1cc2nnc(C)n2c2nnc(C)n12 |
| InChI | InChI=1S/C9H10N6/c1-5-4-8-12-10-7(3)15(8)9-13-11-6(2)14(5)9/h4H,1-3H3 |
| InChIKey | UKDOMONKXPLQHY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |