C8H8N6 — CID 604635
3,12-dimethyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene (PubChem CID 604635) has the molecular formula C8H8N6 and a molecular weight of 188.19 g/mol. Its IUPAC name is 3,12-dimethyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene.
| Compound Name | 3,12-dimethyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 604635 |
| Molecular Formula | C8H8N6 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3,12-dimethyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
| SMILES | Cc1nnc2ccc3nnc(C)n3n12 |
| InChI | InChI=1S/C8H8N6/c1-5-9-11-7-3-4-8-12-10-6(2)14(8)13(5)7/h3-4H,1-2H3 |
| InChIKey | GQGJFRLLZANDGB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |