C8H10N5Y- — CID 59879597
N,N,3-trimethyl-8H-[1,2,4]triazolo[4,3-b]pyridazin-8-id-6-amine;yttrium (PubChem CID 59879597) has the molecular formula C8H10N5Y- and a molecular weight of 265.11 g/mol. Its IUPAC name is N,N,3-trimethyl-8H-[1,2,4]triazolo[4,3-b]pyridazin-8-id-6-amine;yttrium.
| Compound Name | N,N,3-trimethyl-8H-[1,2,4]triazolo[4,3-b]pyridazin-8-id-6-amine;yttrium |
|---|---|
| PubChem CID | 59879597 |
| Molecular Formula | C8H10N5Y- |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | N,N,3-trimethyl-8H-[1,2,4]triazolo[4,3-b]pyridazin-8-id-6-amine;yttrium |
| SMILES | Cc1nnc2[c-]cc(N(C)C)nn12.[Y] |
| InChI | InChI=1S/C8H10N5.Y/c1-6-9-10-7-4-5-8(12(2)3)11-13(6)7;/h5H,1-3H3;/q-1; |
| InChIKey | ZWFBREDQYTZKOF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|