C7H5ClN6 — CID 12583727
3-chloro-12-methyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene (PubChem CID 12583727) has the molecular formula C7H5ClN6 and a molecular weight of 208.61 g/mol. Its IUPAC name is 3-chloro-12-methyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene.
| Compound Name | 3-chloro-12-methyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 12583727 |
| Molecular Formula | C7H5ClN6 |
| Molecular Weight | 208.61 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3-chloro-12-methyl-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
| SMILES | Cc1nnc2ccc3nnc(Cl)n3n12 |
| InChI | InChI=1S/C7H5ClN6/c1-4-9-10-5-2-3-6-11-12-7(8)14(6)13(4)5/h2-3H,1H3 |
| InChIKey | VJEGYNBHDWWMTO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.61 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |