C7H6N6S — CID 15618574
7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione (PubChem CID 15618574) has the molecular formula C7H6N6S and a molecular weight of 206.23 g/mol. Its IUPAC name is 7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione.
| Compound Name | 7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione |
|---|---|
| PubChem CID | 15618574 |
| Molecular Formula | C7H6N6S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 7-methyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione |
| SMILES | Cc1cc2nncn2c2n[nH]c(=S)n12 |
| InChI | InChI=1S/C7H6N6S/c1-4-2-5-9-8-3-12(5)6-10-11-7(14)13(4)6/h2-3H,1H3,(H,11,14) |
| InChIKey | QNYFUAPJDPBGQN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|