C7H7N5S — CID 130648703
6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione (PubChem CID 130648703) has the molecular formula C7H7N5S and a molecular weight of 193.24 g/mol. Its IUPAC name is 6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione.
| Compound Name | 6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 130648703 |
| Molecular Formula | C7H7N5S |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione |
| SMILES | Cn1ncnc1-c1ccnc(=S)[nH]1 |
| InChI | InChI=1S/C7H7N5S/c1-12-6(9-4-10-12)5-2-3-8-7(13)11-5/h2-4H,1H3,(H,8,11,13) |
| InChIKey | YTIMWDSHKHJRCV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|