C7H6FN5S — CID 130900382
5-fluoro-6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione (PubChem CID 130900382) has the molecular formula C7H6FN5S and a molecular weight of 211.23 g/mol. Its IUPAC name is 5-fluoro-6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione.
| Compound Name | 5-fluoro-6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 130900382 |
| Molecular Formula | C7H6FN5S |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 5-fluoro-6-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrimidine-2-thione |
| SMILES | Cn1ncnc1-c1[nH]c(=S)ncc1F |
| InChI | InChI=1S/C7H6FN5S/c1-13-6(10-3-11-13)5-4(8)2-9-7(14)12-5/h2-3H,1H3,(H,9,12,14) |
| InChIKey | RNJZLRNWHMEYSK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|